| Name |
6'-Demethoxypraecansone B
Purpurenone |
| Formula |
C21H20O4 |
| Mw |
336.13615913 |
| CAS RN |
93753-26-5 |
| C_ID |
C00007002
, 
|
| InChIKey |
NTSLHMYMWQPYFF-LGMDPLHJSA-N |
| InChICode |
InChI=1S/C21H20O4/c1-21(2)12-11-16-19(25-21)10-9-15(20(16)24-3)18(23)13-17(22)14-7-5-4-6-8-14/h4-13,22H,1-3H3/b17-13- |
| SMILES |
COc1c(C(=O)/C=C(O)c2ccccc2)ccc2c1C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lonchocarpus subglaucescens | Ref. |
| Plantae | Fabaceae | Millettia erythrocalyx | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
|
|
zoom in
| Organism | Tephrosia purpurea |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Rao,Phytochem.,23,(1984),2339 |
|---|
|
