| Name |
Okanin |
| Formula |
C15H12O6 |
| Mw |
288.06338812 |
| CAS RN |
484-76-4 |
| C_ID |
C00006969
, 
|
| InChIKey |
GSBNFGRTUCCBTK-DAFODLJHSA-N |
| InChICode |
InChI=1S/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(O)c(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens frondosa  | Ref. |
| Plantae | Asteraceae | Bidens sp. | Ref. |
| Plantae | Asteraceae | Coreopsis maritima | Ref. |
| Plantae | Asteraceae | Coreopsis tinctoria | Ref. |
| Plantae | Cyperaceae | Kyllinga brevifolia  | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Fabaceae | Albizia adianthifolia  | Ref. |
| Plantae | Fabaceae | Cylicodiscus gabunensis  | Ref. |
| Plantae | Pinaceae | Abies pindrow  | Ref. |
|
|
zoom in
| Organism | Bidens sp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|