| Name |
Echinatin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
34221-41-5 |
| C_ID |
C00006922
, 
|
| InChIKey |
QJKMIJNRNRLQSS-WEVVVXLNSA-N |
| InChICode |
InChI=1S/C16H14O4/c1-20-16-10-14(18)8-4-12(16)5-9-15(19)11-2-6-13(17)7-3-11/h2-10,17-18H,1H3/b9-5+ |
| SMILES |
COc1cc(O)ccc1/C=C/C(=O)c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Fabaceae | Bauhinia manca | Ref. |
| Plantae | Fabaceae | Glycyrrhiza echinata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glara | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza echinata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Furuya,Tetrahedron Lett.,(1971),2567
Saitoh,Tetrahedron Lett.,(1975),4463 |
|---|
|