| Name |
2',4'-Dihydroxychalcone |
| Formula |
C15H12O3 |
| Mw |
240.07864425 |
| CAS RN |
1776-30-3 |
| C_ID |
C00006920
, 
|
| InChIKey |
JUMSUVHHUVPSOY-RMKNXTFCSA-N |
| InChICode |
InChI=1S/C15H12O3/c16-12-7-8-13(15(18)10-12)14(17)9-6-11-4-2-1-3-5-11/h1-10,16,18H/b9-6+ |
| SMILES |
O=C(/C=C/c1ccccc1)c1ccc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Ceratiola ericoides | Ref. |
| Plantae | Fabaceae | Acacia neovernicosa | Ref. |
| Plantae | Fabaceae | Flemingia chappar | Ref. |
| Plantae | Fabaceae | Glycyrrhiza astragalina  | Ref. |
| Plantae | Meliaceae | Soymida febrifuga  | Ref. |
|
|
zoom in
| Organism | Flemingia chappar | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Adityachaudhury,J.Indian Chem.Soc.,46,(1969),964
Adityachaudhury,Tetrahedron,27,(1971),2111 |
|---|
|