| Name |
Malvidin 3-(6''-p-coumarylglucoside) |
| Formula |
C32H31O14 |
| Mw |
639.1713807 |
| CAS RN |
156577-22-9,158189-28-7 |
| C_ID |
C00006903
, 
|
| InChIKey |
HXQOVGDXCHFLOP-RQJPEPKNNA-O |
| InChICode |
InChI=1S/C32H30O14/c1-41-22-9-16(10-23(42-2)27(22)37)31-24(13-19-20(35)11-18(34)12-21(19)44-31)45-32-30(40)29(39)28(38)25(46-32)14-43-26(36)8-5-15-3-6-17(33)7-4-15/h3-13,25,28-30,32,38-40H,14H2,1-2H3,(H3-,33,34,35,36,37)/p+1/t25-,28-,29+,30-,32-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis cinerea | Ref. |
| Plantae | Vitaceae | Vitis spp.  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis cinerea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Liao,J.Food Sci.,35,(1970),41
Gueffroy,Phytochem.,10,(1971),813 |
|---|
|