| Name |
Petunidin 3-(6''-p-coumarylglucoside) |
| Formula |
C31H29O14 |
| Mw |
625.15573064 |
| CAS RN |
51939-69-6,71991-89-4 |
| C_ID |
C00006896
, 
|
| InChIKey |
KTFQEFWNLAUGAX-JSQOXMNJNA-O |
| InChICode |
InChI=1S/C31H28O14/c1-41-22-9-15(8-20(35)26(22)37)30-23(12-18-19(34)10-17(33)11-21(18)43-30)44-31-29(40)28(39)27(38)24(45-31)13-42-25(36)7-4-14-2-5-16(32)6-3-14/h2-12,24,27-29,31,38-40H,13H2,1H3,(H4-,32,33,34,35,36,37)/p+1/t24-,27-,28-,29-,31-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(COC(=O)/C=C/c3ccc(O)cc3)[C@@H](O)C(O)C2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Vitaceae | Vitis cinerea | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Gonzalez-San,J.Sci.Food Agric.,51,(1990),337
Fong,Phytochem.,13,(1974),1001 |
|---|
|