| Name |
Awobanin Delphinidin-3-(6-O-p-coumarylglucoside)-5-glucoside |
| Formula |
C36H37O19 |
| Mw |
773.192904 |
| CAS RN |
64615-55-0,136031-06-6 |
| C_ID |
C00006884
, 
|
| InChIKey |
HXWHJZIJSNBCJX-NPJIBHEINA-O |
| InChICode |
InChI=1S/C36H36O19/c37-12-24-28(44)30(46)32(48)35(54-24)52-22-10-17(39)9-21-18(22)11-23(34(51-21)15-7-19(40)27(43)20(41)8-15)53-36-33(49)31(47)29(45)25(55-36)13-50-26(42)6-3-14-1-4-16(38)5-2-14/h1-11,24-25,28-33,35-37,44-49H,12-13H2,(H4-,38,39,40,41,42,43)/p+1/t24-,25+,28+,29+,30-,31-,32+,33-,35+,36+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc3c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Hyacinthaceae | Hyacinthus orientalis | Ref. |
| Plantae | Labiatae | Dracocephalum wilsonii | Ref. |
| Plantae | Labiatae | Hyssopus officinalis  | Ref. |
| Plantae | Labiatae | Lallemantia canescens | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Nepeta spp. | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Salvia splendens | Ref. |
| Plantae | Lamiaceae | Horminum pyrenaicum | Ref. |
| Plantae | Themidaceae | Triteleia bridgesii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Dracocephalum wilsonii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Williams,J.Chromatogr.,155,(1978),389
Saito,Phytochem.,31,(1992),3009 |
|---|
|