| Name |
Delphinidin 3-(2''-galloylgalactoside) |
| Formula |
C28H25O16 |
| Mw |
617.11425975 |
| CAS RN |
142609-11-8 |
| C_ID |
C00006875
, 
|
| InChIKey |
DPASDXFUYSHIAA-JTJGCHESNA-O |
| InChICode |
InChI=1S/C28H24O16/c29-8-20-23(38)24(39)26(44-27(40)10-3-16(34)22(37)17(35)4-10)28(43-20)42-19-7-12-13(31)5-11(30)6-18(12)41-25(19)9-1-14(32)21(36)15(33)2-9/h1-7,20,23-24,26,28-29,38-39H,8H2,(H7-,30,31,32,33,34,35,36,37,40)/p+1/t20-,23+,24+,26-,28?/m1/s1 |
| SMILES |
O=C(O[C@@H]1C(O)[C@@H](O)C(CO)O[C@H]1Oc1cc2c(O)cc(O)cc2[o+]c1-c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Nymphaeaceae | Victoria amazonica | Ref. |
| Plantae | Nymphaeaceae | Victoria cruziana | Ref. |
|
|
zoom in
| Organism | Victoria amazonica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Strack,Phytochem.,31,(1992),989 |
|---|
|