| Name |
Peonidin 3-(6''-acetylglucoside) |
| Formula |
C24H25O12 |
| Mw |
505.13460127 |
| CAS RN |
129016-22-4,122796-43-4,114017-67-3 |
| C_ID |
C00006859
, 
|
| InChIKey |
MBSKDCPWFSMEFD-FJYWOMRNNA-O |
| InChICode |
InChI=1S/C24H24O12/c1-10(25)33-9-19-20(29)21(30)22(31)24(36-19)35-18-8-13-15(28)6-12(26)7-16(13)34-23(18)11-3-4-14(27)17(5-11)32-2/h3-8,19-22,24,29-31H,9H2,1-2H3,(H2-,26,27,28)/p+1/t19-,20+,21-,22-,24-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(COC(C)=O)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Virgilia divaricata | Ref. |
| Plantae | Fabaceae | Virgilia oroboides | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis vinifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Van Wyk,Biochem.Syst.Ecol.,22,(1994),813
Baldi,J.Agric.Food Chem.,43,(1995),2104 |
|---|
|