| Name |
Cyanidin 3-[6-(6-ferulylglucosyl)-2-xylosylgalactoside] |
| Formula |
C42H47O23 |
| Mw |
919.25081281 |
| CAS RN |
59942-72-2 |
| C_ID |
C00006833
, 
|
| InChIKey |
MUQNMJSHMPEZCV-DUQJEKCENA-O |
| InChICode |
InChI=1S/C42H46O23/c1-57-26-8-16(2-5-21(26)45)3-7-30(49)58-14-28-32(51)34(53)37(56)40(63-28)60-15-29-33(52)35(54)39(65-41-36(55)31(50)24(48)13-59-41)42(64-29)62-27-12-19-22(46)10-18(43)11-25(19)61-38(27)17-4-6-20(44)23(47)9-17/h2-12,24,28-29,31-37,39-42,48,50-56H,13-15H2,1H3,(H4-,43,44,45,46,47,49)/p+1/t24-,28-,29-,31-,32-,33+,34+,35+,36-,37-,39+,40-,41-,42-/m1/s1 |
| SMILES |
COc1cc(/C=C/C(=O)OCC2O[C@@H](OCC3O[C@@H](Oc4cc5c(O)cc(O)cc5[o+]c4-c4ccc(O)c(O)c4)C(O[C@@H]4OC[C@@H](O)C(O)[C@H]4O)C(O)[C@H]3O)C(O)[C@@H](O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anthriscus sylvestris  | Ref. |
| Plantae | Apiaceae | Apium spp. | Ref. |
| Plantae | Apiaceae | Astrodaucus orientalis  | Ref. |
| Plantae | Apiaceae | Conium maculatum  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Oenanthe crocata  | Ref. |
| Plantae | Apiaceae | Torilis spp. | Ref. |
| Plantae | Apiaceae | Yabea microcarpa | Ref. |
|
|
zoom in
| Organism | Astrodaucus orientalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Biochem.Syst.Ecol.,4,(1976),31
Glassgen,Phytochem.,31,(1992),1593 |
|---|
|