| Name |
Cyanidin 3-(6''-p-coumarylglucoside)-5-4''',6'''-dimalonylglucoside) |
| Formula |
C42H41O24 |
| Mw |
929.19877724 |
| CAS RN |
|
| C_ID |
C00006827
, 
|
| InChIKey |
JJJMVXFRCMSVEA-YCKVDOBINA-O |
| InChICode |
InChI=1S/C42H40O24/c43-19-5-1-17(2-6-19)3-8-31(51)59-15-27-34(54)35(55)37(57)41(64-27)63-26-12-21-24(61-39(26)18-4-7-22(45)23(46)9-18)10-20(44)11-25(21)62-42-38(58)36(56)40(66-33(53)14-30(49)50)28(65-42)16-60-32(52)13-29(47)48/h1-12,27-28,34-38,40-42,54-58H,13-16H2,(H5-,43,44,45,46,47,48,49,50,51)/p+1/t27-,28+,34-,35+,36-,37-,38-,40-,41-,42-/m1/s1 |
| SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc(O)cc3[o+]c(-c4ccc(O)c(O)c4)c(O[C@@H]4OC(COC(=O)/C=C/c5ccc(O)cc5)[C@@H](O)C(O)C4O)cc23)C(O)[C@@H](O)[C@@H]1OC(=O)CC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Agastache aurantiaca | Ref. |
| Plantae | Labiatae | Clinopodium vulgare | Ref. |
| Plantae | Labiatae | Glechoma hederacea  | Ref. |
| Plantae | Labiatae | Salvia castanea  | Ref. |
| Plantae | Labiatae | Salvia greggii | Ref. |
| Plantae | Labiatae | Salvia lineata | Ref. |
| Plantae | Labiatae | Salvia multicaulis  | Ref. |
| Plantae | Labiatae | Stachys macrantha | Ref. |
| Plantae | Labiatae | Stachys officinalis  | Ref. |
|
|
zoom in
| Organism | Glechoma hederacea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Tomas-Barberan,Phytochem.,26,(1987),2759
Saito,Phytochem.,31,(1992),3009 |
|---|
|