| Name |
Ophrysanin |
| Formula |
C23H21O14 |
| Mw |
521.09313038 |
| CAS RN |
104937-44-2 |
| C_ID |
C00006794
, 
|
| InChIKey |
ADNURPZCKUPWPT-YYSCHUJTNA-O |
| InChICode |
InChI=1S/C23H20O14/c24-9-4-12(26)10-6-15(20(35-14(10)5-9)8-1-2-11(25)13(27)3-8)36-23-19(30)18(29)17(28)16(37-23)7-34-22(33)21(31)32/h1-6,16-19,23,28-30H,7H2,(H4-,24,25,26,27,31,32)/p+1/t16-,17-,18-,19+,23-/m1/s1 |
| SMILES |
O=C(O)C(=O)OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orchidaceae | Anacamptis pyramidalis  | Ref. |
| Plantae | Orchidaceae | Barlia spp. | Ref. |
| Plantae | Orchidaceae | Cephalanthera spp. | Ref. |
| Plantae | Orchidaceae | Epipactis atrorubens | Ref. |
| Plantae | Orchidaceae | Himantoglossum adriaticum | Ref. |
| Plantae | Orchidaceae | Limodorum abortivum | Ref. |
| Plantae | Orchidaceae | Neottianthe cucullata | Ref. |
| Plantae | Orchidaceae | Nigritella spp. | Ref. |
| Plantae | Orchidaceae | Ophrys spp. | Ref. |
| Plantae | Orchidaceae | Orchis spp. | Ref. |
| Plantae | Orchidaceae | Serapias spp. | Ref. |
| Plantae | Orchidaceae | Traunsteinera globosa | Ref. |
|
|
zoom in
| Organism | Cephalanthera spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Strack,Z.Naturforsch.,C.,41,(1986),707
Strack,28,(1989),2127 |
|---|
|