| Name |
Pelargonidin 3-(6''-malonylglucoside) |
| Formula |
C24H23O13 |
| Mw |
519.11386582 |
| CAS RN |
165070-68-8 |
| C_ID |
C00006755
, 
|
| InChIKey |
XLZUBCUKXQFBKB-AOJYJDMDNA-O |
| InChICode |
InChI=1S/C24H22O13/c25-11-3-1-10(2-4-11)23-16(7-13-14(27)5-12(26)6-15(13)35-23)36-24-22(33)21(32)20(31)17(37-24)9-34-19(30)8-18(28)29/h1-7,17,20-22,24,31-33H,8-9H2,(H3-,25,26,27,28,29)/p+1/t17-,20-,21-,22-,24-/m1/s1 |
| SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)cc2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio cruentus | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Fabaceae | Lupinus spp. | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
| Plantae | Passifloraceae | Passiflora suberosa | Ref. |
| Plantae | Rosaceae | Fragaria x ananassa | Ref. |
| Plantae | Verbenaceae | Verbena x hybrida | Ref. |
|
|
zoom in
| Organism | Lupinus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Takeda,Phytochem.,25,(1986),1337 |
|---|
|