| Name |
Malvidin 3-rhamnoside |
| Formula |
C23H25O11 |
| Mw |
477.13968664 |
| CAS RN |
53925-28-3 |
| C_ID |
C00006736
, 
|
| InChIKey |
IBKIPCPWNULPMQ-KYMLKBOVNA-O |
| InChICode |
InChI=1S/C23H24O11/c1-9-18(26)20(28)21(29)23(32-9)34-17-8-12-13(25)6-11(24)7-14(12)33-22(17)10-4-15(30-2)19(27)16(5-10)31-3/h4-9,18,20-21,23,26,28-29H,1-3H3,(H2-,24,25,27)/p+1/t9-,18-,20+,21-,23-/m0/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lathyrus sativus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Myrsinaceae | Anagallis arvensis  | Ref. |
| Plantae | Rhamnaceae | Ceanothus sp. | Ref. |
| Plantae | Zygophyllaceae | Zygophyllum album  | Ref. |
|
|
zoom in
| Organism | Anagallis arvensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Statham,Phytochem.,11,(1972),1083 |
|---|
|