| Name |
Oxycoccicyanin Peonidin 3-O-beta-D-glucopyranoside |
| Formula |
C22H23O11.Cl |
| Mw |
498.09288929 |
| CAS RN |
6906-39-4 |
| C_ID |
C00006681
, 
|
| InChIKey |
ZZWPMFROUHHAKY-LHLNPIAMNA-O |
| InChICode |
InChI=1S/C22H22O11/c1-30-15-4-9(2-3-12(15)25)21-16(7-11-13(26)5-10(24)6-14(11)31-21)32-22-20(29)19(28)18(27)17(8-23)33-22/h2-7,17-20,22-23,27-29H,8H2,1H3,(H2-,24,25,26)/p+1/t17-,18-,19-,20-,22-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera caerulea | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asparagaceae | Asparagus cepa | Ref. |
| Plantae | Berberidaceae | Berberis spp. | Ref. |
| Plantae | Convolvulaceae | Ipomoea nil  | Ref. |
| Plantae | Crassulaceae | Cotyledon spp. | Ref. |
| Plantae | Crassulaceae | Crassula spp. | Ref. |
| Plantae | Crassulaceae | Tylecodon spp. | Ref. |
| Plantae | Ericaceae | Gaylussacia spp. | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Trifolium incarnatum | Ref. |
| Plantae | Fabaceae | Virgilia spp. | Ref. |
| Plantae | Magnoliaceae | Magnolia spp. | Ref. |
| Plantae | Myrsinaceae | Ardisia humilis | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Picea spp. | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
| Plantae | Pinaceae | Tsuga spp. | Ref. |
| Plantae | Poaceae | Alopecurus spp. | Ref. |
| Plantae | Poaceae | Anthoxanthum spp. | Ref. |
| Plantae | Poaceae | Avenula spp. | Ref. |
| Plantae | Poaceae | Bothriochloa spp. | Ref. |
| Plantae | Poaceae | Dactylis spp. | Ref. |
| Plantae | Poaceae | Deschampsia spp. | Ref. |
| Plantae | Poaceae | Elymus spp. | Ref. |
| Plantae | Poaceae | Festuca spp. | Ref. |
| Plantae | Poaceae | Hordeum spp. | Ref. |
| Plantae | Poaceae | Miscanthus spp. | Ref. |
| Plantae | Poaceae | Molinia spp. | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Phalaris arundinacea | Ref. |
| Plantae | Poaceae | Phleum spp. | Ref. |
| Plantae | Poaceae | Poa spp. | Ref. |
| Plantae | Poaceae | Secale cereale  | Ref. |
| Plantae | Poaceae | Sinarundinaria spp. | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
| Plantae | Podocarpaceae | Microcachrys tetragona | Ref. |
| Plantae | Podocarpaceae | Podocarpus spp. | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Salicaceae | Salix triandra | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Asparagus cepa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Grove,J.Chem.Soc.,(1931),2722
Francis,Proc.Am.Soc.Hartic.Sci.,89,(1966),657 |
|---|
|