| Name |
Cyanidin 3,3'-diglucoside |
| Formula |
C27H31O16 |
| Mw |
611.16120995 |
| CAS RN |
64963-54-8 |
| C_ID |
C00006668
, 
|
| InChIKey |
MNKUMWVPHXPSLS-ARDLSURDNA-O |
| InChICode |
InChI=1S/C27H30O16/c28-7-17-19(33)21(35)23(37)26(42-17)40-15-3-9(1-2-12(15)31)25-16(6-11-13(32)4-10(30)5-14(11)39-25)41-27-24(38)22(36)20(34)18(8-29)43-27/h1-6,17-24,26-29,33-38H,7-8H2,(H2-,30,31,32)/p+1/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio cruentus | Ref. |
| Plantae | Bromeliaceae | Aechmea weibachii leodiensis | Ref. |
| Plantae | Bromeliaceae | Nidularium innocentii lineatum | Ref. |
| - | - | Bromeliaceae | Ref. |
|
|
zoom in
| Organism | Nidularium innocentii lineatum |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Saito,Phytochem.,22,(1983),1735 |
|---|
|
