| Name |
Seranin |
| Formula |
C27H31O16 |
| Mw |
611.16120995 |
| CAS RN |
64963-53-7 |
| C_ID |
C00006666
, 
|
| InChIKey |
ULXBEUBSYSSVTP-ARDLSURDNA-O |
| InChICode |
InChI=1S/C27H30O16/c28-7-17-19(33)21(35)23(37)26(42-17)39-10-4-13(31)11-6-16(41-27-24(38)22(36)20(34)18(8-29)43-27)25(40-15(11)5-10)9-1-2-12(30)14(32)3-9/h1-6,17-24,26-29,33-38H,7-8H2,(H2-,30,31,32)/p+1/t17-,18-,19-,20-,21+,22-,23-,24+,26-,27-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Althaea rosea  | Ref. |
| Plantae | Orchidaceae | Anacamptis pyramidalis  | Ref. |
| Plantae | Orchidaceae | Barlia spp. | Ref. |
| Plantae | Orchidaceae | Cephalanthera rubra | Ref. |
| Plantae | Orchidaceae | Dactylorhiza spp. | Ref. |
| Plantae | Orchidaceae | Gymnadenia spp. | Ref. |
| Plantae | Orchidaceae | Limodorum abortivum | Ref. |
| Plantae | Orchidaceae | Ophrys spp. | Ref. |
| Plantae | Orchidaceae | Orchis spp. | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
|
|
zoom in
| Organism | Barlia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Birkofer,Z.Naturforsch.,18,(1963),367
Strack,Phytochem.,28,(1989),2127 |
|---|
|