| Name |
Cyanidin 3-rhamnoside |
| Formula |
C21H21O10 |
| Mw |
433.11347189 |
| CAS RN |
38533-30-1 |
| C_ID |
C00006653
, 
|
| InChIKey |
USWXMMRFOWNEOR-UFUPHKAQNA-O |
| InChICode |
InChI=1S/C21H20O10/c1-8-17(26)18(27)19(28)21(29-8)31-16-7-11-13(24)5-10(22)6-15(11)30-20(16)9-2-3-12(23)14(25)4-9/h2-8,17-19,21,26-28H,1H3,(H3-,22,23,24,25)/p+1/t8-,17-,18+,19-,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis spp. | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Plumbaginaceae | Plumbago rosea | Ref. |
| Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
|
|
zoom in
| Organism | Pisum sativum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
|---|
|