| Name |
Lophirone A |
| Formula |
C30H22O8 |
| Mw |
510.13146768 |
| CAS RN |
110383-39-6 |
| C_ID |
C00006587
, 
|
| InChIKey |
ZPIXFZZVVJUNDO-DKKPLQGMNA-N |
| InChICode |
InChI=1S/C30H22O8/c31-18-5-1-16(2-6-18)27(17-3-7-19(32)8-4-17)28(30(37)22-11-9-20(33)13-25(22)35)24-15-38-26-14-21(34)10-12-23(26)29(24)36/h1-15,27-28,31-35H/t28-/m0/s1 |
| SMILES |
O=C(c1ccc(O)cc1O)[C@@H](c1coc2cc(O)ccc2c1=O)C(c1ccc(O)cc1)c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ochnaceae | Lophira alata  | Ref. |
| Plantae | Ochnaceae | Lophira lanceolata  | Ref. |
| Plantae | Ochnaceae | Ochna calodendron | Ref. |
| Plantae | Ochnaceae | Ochna integerrima  | Ref. |
| Plantae | Ochnaceae | Ouratea sulcata | Ref. |
|
|
zoom in
| Organism | Ochna calodendron | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Ghogomu,Tetrahedron Lett.28,(1987),2967 |
|---|
|