| Name |
Podocarpusflavone B Putraflavone |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
23624-21-7 |
| C_ID |
C00006492
, 
|
| InChIKey |
GZTVUTQZSAZUIY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-17-6-3-15(4-7-17)26-14-25(38)31-23(36)12-22(35)29(32(31)42-26)19-9-16(5-8-20(19)33)27-13-24(37)30-21(34)10-18(40-2)11-28(30)41-27/h3-14,33-36H,1-2H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc(-c5cc(=O)c6c(O)cc(OC)cc6o5)ccc4O)c3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Elateriospermum tapos  | Ref. |
| Plantae | Euphorbiaceae | Putranjiva roxburghii  | Ref. |
| Plantae | Podocarpaceae | Podocarpus macrophyllus  | Ref. |
|
|
zoom in
| Organism | Putranjiva roxburghii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,Tetrahedron Lett.,19,(1968),2339
Garg,Phytochem.,10,(1971),2787 |
|---|
|