| Name |
7,7''-Di-O-methylamentoflavone |
| Formula |
C32H22O10 |
| Mw |
566.12129692 |
| CAS RN |
67882-11-5 |
| C_ID |
C00006491
, 
|
| InChIKey |
SVIMIMQAVRQGEK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C32H22O10/c1-39-18-10-21(35)30-22(36)12-26(41-28(30)11-18)16-5-8-20(34)19(9-16)29-27(40-2)14-24(38)31-23(37)13-25(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-35,38H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)c(-c4c(OC)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria excelsa | Ref. |
| Plantae | Cupressaceae | Thuja gigantea | Ref. |
| Plantae | Cupressaceae | Thuja javanica | Ref. |
| Plantae | Taxodiaceae | Taiwania spp. | Ref. |
|
|
zoom in
| Organism | Thuja javanica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Ilyas,Phytochem.,17,(1978),987 |
|---|
|