| Name |
Taiwaniaflavone |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
27090-22-8 |
| C_ID |
C00006446
, 
|
| InChIKey |
IMKDLTDRZZSWPR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)30-26(29(38)28-21(36)9-17(33)11-25(28)40-30)18-7-14(3-6-19(18)34)23-12-22(37)27-20(35)8-16(32)10-24(27)39-23/h1-12,31-36H |
| SMILES |
O=c1cc(-c2ccc(O)c(-c3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Calocedrus macrolepis var.formosana | Ref. |
| Plantae | Cupressaceae | Calocedrus microlepic var. formosana | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
|
|
zoom in
| Organism | Taiwania cryptomerioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Kamil,J.Chem.Soc.Perkin Trans.,1,(1981),553 |
|---|
|