| Name |
Flavosativaside Vitexin 2''-O-glucoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
61360-94-9 |
| C_ID |
C00006392
, 
|
| InChIKey |
FYTOTHFWELWOCG-XZPZFLLANA-N |
| InChICode |
InChI=1S/C27H30O15/c28-7-15-20(35)22(37)26(42-27-23(38)21(36)19(34)16(8-29)41-27)25(40-15)18-12(32)5-11(31)17-13(33)6-14(39-24(17)18)9-1-3-10(30)4-2-9/h1-6,15-16,19-23,25-32,34-38H,7-8H2/t15-,16-,19-,20-,21+,22+,23-,25+,26-,27+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Alternanthera maritima | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Convallariaceae | Polygonatum odoratum  | Ref. |
| Plantae | Molluginaceae | Mollugo cerviana  | Ref. |
| Plantae | Podocarpaceae | Podocarpus totara  | Ref. |
| Plantae | Ruscaceae | Ruscus aculeatus  | Ref. |
|
|
zoom in
| Organism | Silene spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Morita,J.Pharm.Soc.Japan,96,(1976),1180
Segelman,Phytochem.,17,(1978),824 |
|---|
|