| Name |
Neoschaftoside |
| Formula |
C26H28O14 |
| Mw |
564.14790561 |
| CAS RN |
61328-41-4 |
| C_ID |
C00006382
, 
|
| InChIKey |
MMDUKUSNQNWVET-JTQUFEMGNA-N |
| InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13+,17-,18-,21+,22-,23-,25-,26+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@H]3OC[C@H](O)[C@@H](O)C3O)c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia judaica  | Ref. |
| Plantae | Asteraceae | Catananche caerulea | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Violaceae | Viola yedoensis | Ref. |
|
|
zoom in
| Organism | Flourensia cernua | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Proliac,C.R.Acad.Sci.Paris Ser.D,277,(1973),2813
Besson,Phytochem.,23,(1984),159 |
|---|
|