| Name |
6,8-Di-C-alpha-L-arabinopyranosylapigenin Apigenin 6,8-di-C-alpha-L-arabinopyranoside |
| Formula |
C25H26O13 |
| Mw |
534.13734092 |
| CAS RN |
73140-47-3 |
| C_ID |
C00006372
, 
|
| InChIKey |
LDVNKZYMYPZDAI-HYSHVFSVNA-N |
| InChICode |
InChI=1S/C25H26O13/c26-9-3-1-8(2-4-9)13-5-10(27)14-19(32)15(24-21(34)17(30)11(28)6-36-24)20(33)16(23(14)38-13)25-22(35)18(31)12(29)7-37-25/h1-5,11-12,17-18,21-22,24-26,28-35H,6-7H2/t11-,12-,17-,18+,21-,22+,24-,25+/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC[C@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC[C@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Stellaria media  | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Mucuna sempervirens | Ref. |
| Plantae | Labiatae | Schnabelia tetradonta | Ref. |
| Plantae | Metzgeriaceae | Apometzgeria pubescens | Ref. |
| Plantae | Poaceae | Arrhenatherum spp. | Ref. |
| Plantae | Rutaceae | Almeidea guyanensis | Ref. |
|
|
zoom in
| Organism | Mucuna sempervirens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Specht,Phytochem.,15,(1976),133
Jay,Phytochem.,28,(1989),3035 |
|---|
|