| Name |
Orientin 4'-glucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
38950-95-7 |
| C_ID |
C00006201
, 
|
| InChIKey |
DNROMVGLCYTKCA-HQORTFQONA-N |
| InChICode |
InChI=1S/C27H30O16/c28-6-15-19(34)21(36)23(38)26(41-15)18-11(32)4-10(31)17-12(33)5-14(40-25(17)18)8-1-2-13(9(30)3-8)42-27-24(39)22(37)20(35)16(7-29)43-27/h1-5,15-16,19-24,26-32,34-39H,6-7H2/t15-,16-,19-,20-,21+,22+,23-,24-,26+,27-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(O)c2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Genista patula | Ref. |
| Plantae | Fabaceae | Retama raetam  | Ref. |
| Plantae | Passifloraceae | Passiflora coactilis | Ref. |
| Plantae | Poaceae | Briza media | Ref. |
|
|
zoom in
| Organism | Passiflora coactilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Williams,Phytochem.,11,(1972),2507 |
|---|
|