| Name |
Multiflorin A |
| Formula |
C29H32O16 |
| Mw |
636.16903498 |
| CAS RN |
61358-52-9 |
| C_ID |
C00005886
, 
|
| InChIKey |
KXOPSQZLBRPJGX-AHGKAFSKNA-N |
| InChICode |
InChI=1S/C29H32O16/c1-10-25(44-29-23(38)21(36)19(34)17(43-29)9-40-11(2)30)22(37)24(39)28(41-10)45-27-20(35)18-15(33)7-14(32)8-16(18)42-26(27)12-3-5-13(31)6-4-12/h3-8,10,17,19,21-25,28-29,31-34,36-39H,9H2,1-2H3/t10-,17+,19+,21-,22+,23+,24-,25-,28+,29-/m0/s1 |
| SMILES |
CC(=O)OCC1O[C@@H](O[C@H]2C(C)O[C@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)[C@@H](O)C2O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polypodiaceae | Arthromeris mairei | Ref. |
| Plantae | Rosaceae | Prunus japonica  | Ref. |
| Plantae | Rosaceae | Prunus persica | Ref. |
| Plantae | Rosaceae | Rosa multiflora | Ref. |
| Plantae | Rosaceae | Rosa mutiflora | Ref. |
|
|
zoom in
| Organism | Prunus persica |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Yamasaki,Tetrahedron Lett.,(1977),1231
Seto,Chem.Pharm.Bull.,40,(1992),2080 |
|---|
|
