| Name |
Kaempferol 3-O-beta-D-(6''-E-p-coumaroyl)glucopyranoside Tiliroside Kaempferol 3-O-beta-D-(6''-coumaroyl)-glucopyranoside Potengriffioside A |
| Formula |
C30H26O13 |
| Mw |
594.13734092 |
| CAS RN |
20316-62-5 |
| C_ID |
C00005851
, 
|
| InChIKey |
DVGGLGXQSFURLP-PMXORBILNA-N |
| InChICode |
InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26-,27-,30+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Aerva lanata  | Ref. |
| Plantae | Asteraceae | Anaphalis contorta Hooker  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Cistaceae | Helianthemum glomeratum | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Elaeagnaceae | Shepherdia argentea  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fagaceae | Quercus ilex  | Ref. |
| Plantae | Fagaceae | Quercus suber  | Ref. |
| Plantae | Labiatae | Leonurus heterophyllus  | Ref. |
| Plantae | Labiatae | Phlomis spectabilis | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Malvaceae | Colona auriculata  | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Malvaceae | Tilia argentea | Ref. |
| Plantae | Malvaceae | Tilia spp.  | Ref. |
| Plantae | Melastomataceae | Miconia cabucu | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pinus contorta  | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Rosaceae | Fragaria ananassa  | Ref. |
| Plantae | Rosaceae | Polylepis incana | Ref. |
| Plantae | Rosaceae | Potentilla anserina  | Ref. |
| Plantae | Rosaceae | Potentilla griffithii var.velutina | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Sparuna apiosyce | Ref. |
|
|
zoom in
| Organism | Helichrysum italicum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhong, et al., CTHD, 31, (2000), 488.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Cong, et al., Zhongguo Yaowu Huaxue Zazhi, 13, (2003), 349.
Calixto, et al., Planta Med, 69, (2003), 973.
Tsukamoto, et al., JNP, 67, (2004), 1839.
Kiss, et al., Planta Med, 70, (2004), 919.
Peng, et al., Chinese J of Pharm Analysis, 30, (2010), 633 |
|---|
|