| Name |
Kaempferol 3-(6''-malonylglucoside) 6''-Malonylastragalin Kaempferol 3-o-beta-D-(6''-o-malonyl)-glucoside |
| Formula |
C24H22O14 |
| Mw |
534.10095541 |
| CAS RN |
81149-02-2 |
| C_ID |
C00005844
, 
|
| InChIKey |
XEXCLTHHXIWUHO-ARDHPIDCNA-N |
| InChICode |
InChI=1S/C24H22O14/c25-10-3-1-9(2-4-10)22-23(19(32)17-12(27)5-11(26)6-13(17)36-22)38-24-21(34)20(33)18(31)14(37-24)8-35-16(30)7-15(28)29/h1-6,14,18,20-21,24-27,31,33-34H,7-8H2,(H,28,29)/t14-,18-,20-,21+,24+/m1/s1 |
| SMILES |
O=C(O)CC(=O)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aspleniaceae | Ceterach officinarum  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Equisetaceae | Equisetum spp. | Ref. |
| Plantae | Fabaceae | Cicer sp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
|
|
zoom in
| Organism | Equisetum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Imperato,Chem.Ind.(London),(1981),695
Veit,Biochem.Syst.Ecol.,23,(1995),79 |
|---|
|