| Name |
Icariside I |
| Formula |
C27H30O11 |
| Mw |
530.1788118 |
| CAS RN |
56725-99-6 |
| C_ID |
C00005819
, 
|
| InChIKey |
IYCPMVXIUPYNHI-ARUREYLWNA-N |
| InChICode |
InChI=1S/C27H30O11/c1-12(2)4-9-15-17(36-27-24(34)22(32)20(30)18(11-28)37-27)10-16(29)19-21(31)23(33)25(38-26(15)19)13-5-7-14(35-3)8-6-13/h4-8,10,18,20,22,24,27-30,32-34H,9,11H2,1-3H3/t18-,20-,22+,24-,27-/m1/s1 |
| SMILES |
COc1ccc(-c2oc3c(CC=C(C)C)c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
| Plantae | Berberidaceae | Epimedium grandiflorum  | Ref. |
| Plantae | Berberidaceae | Epimedium pubescens  | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
|
|
zoom in
| Organism | Epimedium pubescens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Tokuoka,Yakugaku Zasshi,95,(1975),825
Mizuno,Phytochem.,26,(1987),861 |
|---|
|