| Name |
Ikarisoside F |
| Formula |
C31H36O14 |
| Mw |
632.21050586 |
| CAS RN |
113558-14-8 |
| C_ID |
C00005807
, 
|
| InChIKey |
ASPIQZXMZNLGRL-FCBGNLNSNA-N |
| InChICode |
InChI=1S/C31H36O14/c1-12(2)4-9-16-17(33)10-18(34)20-23(38)28(26(43-27(16)20)14-5-7-15(32)8-6-14)44-31-29(24(39)21(36)13(3)42-31)45-30-25(40)22(37)19(35)11-41-30/h4-8,10,13,19,21-22,24-25,29-37,39-40H,9,11H2,1-3H3/t13-,19+,21-,22-,24+,25-,29-,30-,31-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c(O[C@@H]3OC(C)[C@H](O)C(O)[C@@H]3O[C@@H]3OC[C@@H](O)C(O)[C@H]3O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Berberidaceae | Epimedium grandiflorum  | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Berberidaceae | Epimedium pubescens  | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Berberidaceae | Epimedium wushanense  | Ref. |
| Plantae | Berberidaceae | Vancouveria hexandra | Ref. |
|
|
zoom in
| Organism | Epimedium koreanum | | Reference | Guo, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 21, (1996), 290.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|