| Name |
Syringetin 3-glucoside Syringetin 3-O-glucoside |
| Formula |
C23H24O13 |
| Mw |
508.12169086 |
| CAS RN |
40039-49-4 |
| C_ID |
C00005777
, 
|
| InChIKey |
JMFWYRWPJVEZPV-WKBAQWBFNA-N |
| InChICode |
InChI=1S/C23H24O13/c1-32-12-3-8(4-13(33-2)16(12)27)21-22(18(29)15-10(26)5-9(25)6-11(15)34-21)36-23-20(31)19(30)17(28)14(7-24)35-23/h3-6,14,17,19-20,23-28,30-31H,7H2,1-2H3/t14-,17-,19-,20+,23+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Cedrus spp. | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Larix laricina  | Ref. |
| Plantae | Pinaceae | Larix leptolepis | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Pinus jeffreyi | Ref. |
| Plantae | Saxifragaceae | Heuchera cylindrica | Ref. |
| Plantae | Saxifragaceae | Heuchera micrantha | Ref. |
|
|
zoom in
| Organism | Larix laricina | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Niemann,Phytochem.,12,(1973),2056
Wilkins,Can.J.Bot.,54,(1976),2133 |
|---|
|