| Name |
Laricitrin 3,5'-diglucoside |
| Formula |
C28H32O18 |
| Mw |
656.15886422 |
| CAS RN |
89345-43-7 |
| C_ID |
C00005766
, 
|
| InChIKey |
BFXKRZMRMYMPJH-NLBXINTRNA-N |
| InChICode |
InChI=1S/C28H32O18/c1-41-12-2-8(3-13(17(12)33)43-27-23(39)21(37)18(34)14(6-29)44-27)25-26(20(36)16-10(32)4-9(31)5-11(16)42-25)46-28-24(40)22(38)19(35)15(7-30)45-28/h2-5,14-15,18-19,21-24,27-35,37-40H,6-7H2,1H3/t14-,15-,18-,19-,21+,22+,23-,24-,27-,28+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)cc(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
|
|
zoom in
| Organism | Medicago sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|