| Name |
Chrysosplenoside A |
| Formula |
C24H26O13 |
| Mw |
522.13734092 |
| CAS RN |
23615-30-7 |
| C_ID |
C00005723
, 
|
| InChIKey |
UYJTVQRUQFFUCY-FGKDQQSYNA-N |
| InChICode |
InChI=1S/C24H26O13/c1-32-9-4-12(27)17-15(5-9)35-22(23(34-3)19(17)29)10-6-11(26)14(33-2)7-13(10)36-24-21(31)20(30)18(28)16(8-25)37-24/h4-7,16,18,20-21,24-28,30-31H,8H2,1-3H3/t16-,18-,20+,21-,24-/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(OC)cc3O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Saxifragaceae | Chrysosplenium americanum | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium glechomaefolium | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium grayanum | Ref. |
|
|
zoom in
| Organism | Chrysosplenium grayanum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Morita,Yakugaku Zasshi,88,(1968),1277
Bohm,Biochem.Syst.Ecol.,7,(1979),195 |
|---|
|