| Name |
Gossypetin 8-glucuronide |
| Formula |
C21H18O14 |
| Mw |
494.06965529 |
| CAS RN |
55366-56-8 |
| C_ID |
C00005691
, 
|
| InChIKey |
KHVMAMXQPVHXTJ-UCYKWPQYNA-N |
| InChICode |
InChI=1S/C21H18O14/c22-6-2-1-5(3-7(6)23)16-13(28)11(26)10-8(24)4-9(25)17(18(10)33-16)34-21-15(30)12(27)14(29)19(35-21)20(31)32/h1-4,12,14-15,19,21-25,27-30H,(H,31,32)/t12-,14-,15+,19-,21+/m0/s1 |
| SMILES |
O=C(O)C1O[C@@H](Oc2c(O)cc(O)c3c(=O)c(O)c(-c4ccc(O)c(O)c4)oc23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum album  | Ref. |
| Plantae | Malvaceae | Hibiscus vitifolius  | Ref. |
| Plantae | Malvaceae | Melochia corchorifolia  | Ref. |
|
|
zoom in
| Organism | Melochia corchorifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nair,Indian J.Chem.,12,(1974),890
Wolbis,Phytochem.,28,(1989),2187 |
|---|
|