| Name |
Centaurein |
| Formula |
C24H26O13 |
| Mw |
522.13734092 |
| CAS RN |
35595-03-0 |
| C_ID |
C00005675
, 
|
| InChIKey |
GGMCFLXPZMBJMV-QOFGLXMFNA-N |
| InChICode |
InChI=1S/C24H26O13/c1-32-11-5-4-9(6-10(11)26)21-23(34-3)18(29)15-12(35-21)7-13(22(33-2)17(15)28)36-24-20(31)19(30)16(27)14(8-25)37-24/h4-7,14,16,19-20,24-28,30-31H,8H2,1-3H3/t14-,16+,19-,20-,24+/m0/s1 |
| SMILES |
COc1ccc(-c2oc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c(OC)c(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Brickellia glutinosBrickellia glutinosa | Ref. |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Asteraceae | Tetragonotheca helianthoides | Ref. |
|
|
zoom in
| Organism | Tetragonotheca helianthoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bridel,C.R.Hebd.Seances Acad.Sci.,175,(1923),1168 |
|---|
|