| Name |
Typhaneoside |
| Formula |
C34H42O20 |
| Mw |
770.22694379 |
| CAS RN |
104472-68-6 |
| C_ID |
C00005573
, 
|
| InChIKey |
POMAQDQEVHXLGT-PCRRGYMMNA-N |
| InChICode |
InChI=1S/C34H42O20/c1-10-20(38)24(42)27(45)32(49-10)48-9-18-22(40)26(44)31(54-33-28(46)25(43)21(39)11(2)50-33)34(52-18)53-30-23(41)19-15(37)7-13(35)8-17(19)51-29(30)12-4-5-14(36)16(6-12)47-3/h4-8,10-11,18,20-22,24-28,31-40,42-46H,9H2,1-3H3/t10-,11-,18+,20-,21-,22-,24-,25+,26-,27+,28-,31-,32+,33-,34-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Typhaceae | Typha angustifolia  | Ref. |
| Plantae | Typhaceae | Typha latifolia  | Ref. |
|
|
zoom in
| Organism | Typha angustata | | Reference | Jia, et al., APS, 21, (1986), 441.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|