| Name |
Quercetin 3-vicianoside |
| Formula |
C26H28O16 |
| Mw |
596.13773485 |
| CAS RN |
23284-18-6 |
| C_ID |
C00005404
, 
|
| InChIKey |
YNMFDPCLPIMRFD-WVUQAUGGNA-N |
| InChICode |
InChI=1S/C26H28O16/c27-9-4-12(30)16-14(5-9)40-23(8-1-2-10(28)11(29)3-8)24(19(16)34)42-26-22(37)20(35)18(33)15(41-26)7-39-25-21(36)17(32)13(31)6-38-25/h1-5,13,15,17-18,20-22,25-33,35-37H,6-7H2/t13-,15+,17+,18+,20-,21+,22-,25+,26-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO[C@@H]3OC[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Menyanthaceae | Nymphoides peltatum | Ref. |
| Plantae | Podocarpaceae | Dacrydium colensoi | Ref. |
|
|
zoom in
| Organism | Nymphoides peltatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Lebreton,C.R.Acad.Sci.Paris.Ser.D,268,(1969),1661 |
|---|
|