| Name |
Avicularin Avicularine Avicularoside Quercetin 3-alpha-L-arabinofuranoside Quercetin 3-O-alpha-L-arabinofuranoside |
| Formula |
C20H18O11 |
| Mw |
434.08491142 |
| CAS RN |
572-30-5 |
| C_ID |
C00005367
, 
|
| InChIKey |
BDCDNTVZSILEOY-UYJXXPCPNA-N |
| InChICode |
InChI=1S/C20H18O11/c21-6-13-15(26)17(28)20(30-13)31-19-16(27)14-11(25)4-8(22)5-12(14)29-18(19)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,20-26,28H,6H2/t13-,15+,17+,20-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@@H](CO)[C@@H](O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Ericaceae | Arctostaphylos uva-ursi  | Ref. |
| Plantae | Ericaceae | Ledum palustre  | Ref. |
| Plantae | Ericaceae | Richea angustifolia | Ref. |
| Plantae | Ericaceae | Richea scoparia | Ref. |
| Plantae | Ericaceae | Vaccinium myritillus | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Hypericum scabrum  | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Myrtaceae | Pimenta dioica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Dryas octopetala  | Ref. |
| Plantae | Solanaceae | Solanum glaucophyllum  | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| - | - | Tapirira guianensis  | Ref. |
|
|
zoom in
| Organism | Ledum palustre | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Ice,J.Am.Chem.Soc.,75,(1953),50
Geiger,Phytochem.,18,(1979),1709 |
|---|
|