| Name |
Sexangularetin 3-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
51857-20-6 |
| C_ID |
C00005356
, 
|
| InChIKey |
LZSGYESPQHEVBU-NRTLMDCONA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-19-11(26)6-10(25)13-15(28)21(18(33-20(13)19)8-2-4-9(24)5-3-8)34-22-17(30)16(29)14(27)12(7-23)32-22/h2-6,12,14,16-17,22-27,29-30H,7H2,1H3/t12-,14-,16+,17-,22+/m1/s1 |
| SMILES |
COc1c(O)cc(O)c2c(=O)c(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Rosaceae | Crataegus monogyna  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Sorbus aucuparia  | Ref. |
| Plantae | Zygophyllaceae | Fagonia thebaica | Ref. |
| - | - | Humata pectinata | Ref. |
|
|
zoom in
| Organism | Crataegus monogyna | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Jerzmanowska,Rocz Chem.,47,(1973),1629 |
|---|
|