| Name |
Rhamnocitrin 3-rhamninoside |
| Formula |
C34H42O19 |
| Mw |
754.23202916 |
| CAS RN |
39723-40-5 |
| C_ID |
C00005282
, 
|
| InChIKey |
MQMTVWHXCSRCER-BFUQLGIMNA-N |
| InChICode |
InChI=1S/C34H42O19/c1-11-20(37)24(41)26(43)33(49-11)52-30-21(38)12(2)48-32(28(30)45)47-10-18-22(39)25(42)27(44)34(51-18)53-31-23(40)19-16(36)8-15(46-3)9-17(19)50-29(31)13-4-6-14(35)7-5-13/h4-9,11-12,18,20-22,24-28,30,32-39,41-45H,10H2,1-3H3/t11-,12+,18-,20+,21+,22-,24+,25-,26-,27-,28-,30+,32-,33+,34+/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)c(O[C@@H]3OC(CO[C@@H]4OC(C)[C@H](O)[C@H](O[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)C4O)[C@H](O)C(O)C3O)c(-c3ccc(O)cc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cercidiphyllaceae | Cercidiphyllum japonicum | Ref. |
| Plantae | Rhamnaceae | Rhamnus leptophylla | Ref. |
| Plantae | Rhamnaceae | Rhamnus nepalensis | Ref. |
| Plantae | Rhamnaceae | Rhamnus thymifolius | Ref. |
|
|
zoom in
| Organism | Rhamnus nepalensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Plouvier,Hebd.Seances Acad.Sci.Ser.D,287(1978),567 |
|---|
|