| Name |
Kaempferol 7-O-rhamnoside Kaempferol 7-O-alpha-L-rhamnopyranoside Kaempferol 7-rhamnoside Kaempferol-7-rhamnoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
20196-89-8 |
| C_ID |
C00005150
, 
|
| InChIKey |
HQNOUCSPWAGQND-OKBQHECNNA-N |
| InChICode |
InChI=1S/C21H20O10/c1-8-15(24)17(26)19(28)21(29-8)30-11-6-12(23)14-13(7-11)31-20(18(27)16(14)25)9-2-4-10(22)5-3-9/h2-8,15,17,19,21-24,26-28H,1H3/t8-,15-,17-,19+,21-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Cactaceae | Cephalocereus senilis | Ref. |
| Plantae | Celastraceae | Celastrus orbiculatus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium ambrosioides  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Crassulaceae | Hylotelephium mingiinianum | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Crassulaceae | Sedum telephium  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Cruciferae | Matthiola incana R.Br.  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Siraitia grosvenori | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Equisetaceae | Equisetum palustre | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Equisetaceae | Equisetum telmateja | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Macroptilium spp. | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Oxytropis glabra | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Robinia neomexicana | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Vigna luteola | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Liliaceae | Lilium regale | Ref. |
| Plantae | Platanaceae | Platanus acerifolia | Ref. |
| Plantae | Ranunculaceae | Delphinium formosum | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Celastrus orbiculatus | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|