| Name |
3,6-Dimethoxy-6'',6''-dimethylpyrano[2,3:7,8]flavone |
| Formula |
C22H20O5 |
| Mw |
364.13107375 |
| CAS RN |
61755-75-7 |
| C_ID |
C00005074
, 
|
| InChIKey |
HIMWSGBRGFKFJN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H20O5/c1-22(2)11-10-14-19-15(12-16(24-3)20(14)27-22)17(23)21(25-4)18(26-19)13-8-6-5-7-9-13/h5-12H,1-4H3 |
| SMILES |
COc1cc2c(=O)c(OC)c(-c3ccccc3)oc2c2c1OC(C)(C)C=C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dahlstedtia pentaphylla | Ref. |
| Plantae | Fabaceae | Derris araripensis | Ref. |
| Plantae | Fabaceae | Derris obtusa | Ref. |
|
|
zoom in
| Organism | Derris obtusa |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
do Nascimento,Phytochem.,15,(1976),1553
do Nascimento,Phytochem.,20,(1981),147 |
|---|
|
