| Name |
5-Hydroxy-3,6,7,8-tetramethoxy-3',4'-methylenedioxyflavone 5-Demethylmelibentin 2-(1,3-Benzodioxol-5-yl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H18O9 |
| Mw |
402.09508217 |
| CAS RN |
5071-28-3 |
| C_ID |
C00005065
, 
|
| InChIKey |
PRTCFQOQYWNVJL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O9/c1-23-17-13(21)12-14(22)18(24-2)20(26-4)19(25-3)16(12)29-15(17)9-5-6-10-11(7-9)28-8-27-10/h5-7,22H,8H2,1-4H3 |
| SMILES |
COc1c(OC)c(O)c2c(=O)c(OC)c(-c3ccc4c(c3)OCO4)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Melicope subunifoliolata (Stapf) T.G.Hartley | Ref. |
| Plantae | Rutaceae | Melicope ternata  | Ref. |
| Plantae | Rutaceae | Melicope triphylla | Ref. |
| Plantae | Rutaceae | Pelea barbigera | Ref. |
|
|
zoom in
| Organism | Melicope triphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Higa,J.Chem.Soc.Perkin Trans,1,(1974),1350
Higa,Yakugaku Zasshi,110,(1990),822 |
|---|
|