| Name |
Melisimplexin 3,5,6,7-Tetramethoxy-3',4'-methylenedioxyflavone 2-(1,3-Benzodioxol-5-yl)-3,5,6,7-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H18O8 |
| Mw |
386.10016755 |
| CAS RN |
479-77-6 |
| C_ID |
C00005054
, 
|
| InChIKey |
ATKXYPOHHYVHEQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O8/c1-22-14-8-13-15(19(24-3)18(14)23-2)16(21)20(25-4)17(28-13)10-5-6-11-12(7-10)27-9-26-11/h5-8H,9H2,1-4H3 |
| SMILES |
COc1cc2oc(-c3ccc4c(c3)OCO4)c(OC)c(=O)c2c(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Melicope broadbentiana | Ref. |
| Plantae | Rutaceae | Melicope octandra | Ref. |
| Plantae | Rutaceae | Melicope simplex | Ref. |
| Plantae | Rutaceae | Melicope subunifoliolata (Stapf) T.G.Hartley | Ref. |
| Plantae | Rutaceae | Melicope ternata  | Ref. |
| Plantae | Rutaceae | Melicope triphylla | Ref. |
|
|
zoom in
| Organism | Melicope simplex | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Briggs,J.Chem.Soc.,(1950),2376 |
|---|
|