| Name |
Noranhydroicaritin 8-Prenylkaempferol De-O-methylanhydroicaritin Desmethylicaritin 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
28610-31-3 |
| C_ID |
C00005000
, 
|
| InChIKey |
NADCVNHITZNGJU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O6/c1-10(2)3-8-13-14(22)9-15(23)16-17(24)18(25)19(26-20(13)16)11-4-6-12(21)7-5-11/h3-7,9,21-23,25H,8H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Burseraceae | Bursera leptophloeos | Ref. |
| Plantae | Fabaceae | Sophora angustifolia | Ref. |
|
|
zoom in
| Organism | Sophora angustifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Komatsu,Yakugaku Zasshi,90,(1970),463 |
|---|
|