| Name |
Quercetagetin 3-methyl ether 7-O-sulfate |
| Formula |
C16H12O11S |
| Mw |
412.01003196 |
| CAS RN |
76060-27-0 |
| C_ID |
C00004977
, 
|
| InChIKey |
QOBBVPZWFXTPBO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O11S/c1-25-16-14(21)11-9(5-10(12(19)13(11)20)27-28(22,23)24)26-15(16)6-2-3-7(17)8(18)4-6/h2-5,17-20H,1H3,(H,22,23,24) |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2cc(OS(=O)(=O)O)c(O)c(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Neurolaena lobata  | Ref. |
| Plantae | Asteraceae | Neurolaena macrocephala | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
|
|
zoom in
| Organism | Neurolaena oaxacana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ulubelen,Phytochem.,19,(1980),1761 |
|---|
|