| Name |
Isorhamnetin 3,7-di-O-sulfate |
| Formula |
C16H12O13S2 |
| Mw |
475.97193193 |
| CAS RN |
79174-97-3 |
| C_ID |
C00004970
, 
|
| InChIKey |
ROYNQIRDSFCDQL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O13S2/c1-26-11-4-7(2-3-9(11)17)15-16(29-31(23,24)25)14(19)13-10(18)5-8(6-12(13)27-15)28-30(20,21)22/h2-6,17-18H,1H3,(H,20,21,22)(H,23,24,25) |
| SMILES |
COc1cc(-c2oc3cc(OS(=O)(=O)O)cc(O)c3c(=O)c2OS(=O)(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Flaveria bidentis  | Ref. |
| Plantae | Asteraceae | Iphiona scabra | Ref. |
| Plantae | Asteraceae | Pluchea dioscorides  | Ref. |
| Plantae | Asteraceae | Senecio spp.  | Ref. |
|
|
zoom in
| Organism | Pluchea dioscorides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Cabrera,Phytochem.,16,(1977),400 |
|---|
|