| Name |
6-C-Methylquercetin 3-methyl ether |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
156298-98-5 |
| C_ID |
C00004896
, 
|
| InChIKey |
JEIHCEATBDDAQS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-7-10(19)6-12-13(14(7)21)15(22)17(23-2)16(24-12)8-3-4-9(18)11(20)5-8/h3-6,18-21H,1-2H3 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2cc(O)c(C)c(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Piliostigma reticulatum | Ref. |
| Plantae | Fabaceae | Piliostigma thonningii  | Ref. |
| Plantae | Velloziaceae | Vellozia phalocarpa | Ref. |
| Plantae | Velloziaceae | Xerophyta retinervis  | Ref. |
|
|
zoom in
| Organism | Vellozia phalocarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Harborne,Phytochem.,35,(1994),1475 |
|---|
|