| Name |
5,7-Dihydroxy-3,6,8,3',4',5'-hexamethoxyflavone 5,7-Dihydroxy-3,6,8-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
96887-18-2 |
| C_ID |
C00004868
, 
|
| InChIKey |
QXRNWRWFNALYGH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O10/c1-25-10-7-9(8-11(26-2)17(10)27-3)16-20(29-5)14(23)12-13(22)19(28-4)15(24)21(30-6)18(12)31-16/h7-8,22,24H,1-6H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2OC)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia grandis | Ref. |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
|
|
zoom in
| Organism | Gymnosperma glutinosum | | Reference | Wollenweber,Proceeding of the International Compositae Conference,vol 1,(1994)
Hind,Royal Botanic Gardens,Kew,(1996)
Wollenweber,Z.Naturforsch.,52c,(1997),301 |
|---|
|